C9H16O4 — CID 91255749
5,6-dihydroxy-2,3-dimethylhept-2-enoic acid (PubChem CID 91255749) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 5,6-dihydroxy-2,3-dimethylhept-2-enoic acid.
| Compound Name | 5,6-dihydroxy-2,3-dimethylhept-2-enoic acid |
|---|---|
| PubChem CID | 91255749 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 5,6-dihydroxy-2,3-dimethylhept-2-enoic acid |
| SMILES | CC(CC(O)C(C)O)=C(C)C(=O)O |
| InChI | InChI=1S/C9H16O4/c1-5(6(2)9(12)13)4-8(11)7(3)10/h7-8,10-11H,4H2,1-3H3,(H,12,13) |
| InChIKey | IYJAUVGWEYWRSY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|