C7H14N2S2 — CID 87478201
3,5-diaminoheptanedithial (PubChem CID 87478201) has the molecular formula C7H14N2S2 and a molecular weight of 190.34 g/mol. Its IUPAC name is 3,5-diaminoheptanedithial.
| Compound Name | 3,5-diaminoheptanedithial |
|---|---|
| PubChem CID | 87478201 |
| Molecular Formula | C7H14N2S2 |
| Molecular Weight | 190.34 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 3,5-diaminoheptanedithial |
| SMILES | NC(CC=S)CC(N)CC=S |
| InChI | InChI=1S/C7H14N2S2/c8-6(1-3-10)5-7(9)2-4-11/h3-4,6-7H,1-2,5,8-9H2 |
| InChIKey | MEQHTWWNTUCUJO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|