C8H18N2 — CID 55289996
1-N-propan-2-ylpent-4-ene-1,2-diamine (PubChem CID 55289996) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 1-N-propan-2-ylpent-4-ene-1,2-diamine.
| Compound Name | 1-N-propan-2-ylpent-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 55289996 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 1-N-propan-2-ylpent-4-ene-1,2-diamine |
| SMILES | C=CCC(N)CNC(C)C |
| InChI | InChI=1S/C8H18N2/c1-4-5-8(9)6-10-7(2)3/h4,7-8,10H,1,5-6,9H2,2-3H3 |
| InChIKey | CEHGSDCCIBSCSK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|