C13H25N — CID 11954735
(4S,6S)-6,10-dimethylundeca-1,9-dien-4-amine (PubChem CID 11954735) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (4S,6S)-6,10-dimethylundeca-1,9-dien-4-amine.
| Compound Name | (4S,6S)-6,10-dimethylundeca-1,9-dien-4-amine |
|---|---|
| PubChem CID | 11954735 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (4S,6S)-6,10-dimethylundeca-1,9-dien-4-amine |
| SMILES | C=CC[C@H](N)C[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C13H25N/c1-5-7-13(14)10-12(4)9-6-8-11(2)3/h5,8,12-13H,1,6-7,9-10,14H2,2-4H3/t12-,13-/m0/s1 |
| InChIKey | UYLCSDGYBSTPDM-STQMWFEESA-N |
| XLogP | 3.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|