About 4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one
4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one (PubChem CID 159336901) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one |
| PubChem CID | 159336901 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one |
| SMILES | C=C(C)C(C)=O.CC(=O)C(C)CO |
| InChI | InChI=1S/C5H10O2.C5H8O/c1-4(3-6)5(2)7;1-4(2)5(3)6/h4,6H,3H2,1-2H3;1H2,2-3H3 |
| InChIKey | LFQRJGAACURQEY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one?
The IUPAC name of 4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one (CID 159336901) is 4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one.
What is the SMILES notation for 4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one?
The canonical SMILES for 4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one is C=C(C)C(C)=O.CC(=O)C(C)CO.
What is the InChIKey of 4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one?
The InChIKey is LFQRJGAACURQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C5H8O/c1-4(3-6)5(2)7;1-4(2)5(3)6/h4,6H,3H2,1-2H3;1H2,2-3H3.
What are the key properties of 4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one?
4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one has a molecular weight of 186.25 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-methylbutan-2-one;3-methylbut-3-en-2-one is sourced from PubChem (CID 159336901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).