C6H11NO3 — CID 87061144
N-[(2R)-1,3-dihydroxybut-3-en-2-yl]acetamide (PubChem CID 87061144) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is N-[(2R)-1,3-dihydroxybut-3-en-2-yl]acetamide.
| Compound Name | N-[(2R)-1,3-dihydroxybut-3-en-2-yl]acetamide |
|---|---|
| PubChem CID | 87061144 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | N-[(2R)-1,3-dihydroxybut-3-en-2-yl]acetamide |
| SMILES | C=C(O)[C@@H](CO)NC(C)=O |
| InChI | InChI=1S/C6H11NO3/c1-4(9)6(3-8)7-5(2)10/h6,8-9H,1,3H2,2H3,(H,7,10)/t6-/m1/s1 |
| InChIKey | VZLYCIXXGJYAAT-ZCFIWIBFSA-N |
| XLogP | -0.44 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|