C5H12OS — CID 10154043
(2R,3S)-2-methyl-3-sulfanylbutan-1-ol (PubChem CID 10154043) has the molecular formula C5H12OS and a molecular weight of 120.22 g/mol. Its IUPAC name is (2R,3S)-2-methyl-3-sulfanylbutan-1-ol.
| Compound Name | (2R,3S)-2-methyl-3-sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 10154043 |
| Molecular Formula | C5H12OS |
| Molecular Weight | 120.22 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | (2R,3S)-2-methyl-3-sulfanylbutan-1-ol |
| SMILES | C[C@H](S)[C@H](C)CO |
| InChI | InChI=1S/C5H12OS/c1-4(3-6)5(2)7/h4-7H,3H2,1-2H3/t4-,5+/m1/s1 |
| InChIKey | RFMHFOPFUZZBAD-UHNVWZDZSA-N |
| XLogP | 0.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|