C7H16OS — CID 88583257
(2S)-2,3-dimethyl-4-methylsulfanylbutan-1-ol (PubChem CID 88583257) has the molecular formula C7H16OS and a molecular weight of 148.27 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-4-methylsulfanylbutan-1-ol.
| Compound Name | (2S)-2,3-dimethyl-4-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 88583257 |
| Molecular Formula | C7H16OS |
| Molecular Weight | 148.27 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (2S)-2,3-dimethyl-4-methylsulfanylbutan-1-ol |
| SMILES | CSCC(C)[C@H](C)CO |
| InChI | InChI=1S/C7H16OS/c1-6(4-8)7(2)5-9-3/h6-8H,4-5H2,1-3H3/t6-,7?/m1/s1 |
| InChIKey | KKFXAJBDBZOSMI-ULUSZKPHSA-N |
| XLogP | 1.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |