C10H23NO4 — CID 90832132
1-(1-amino-1-hydroxy-3-methylpentan-2-yl)oxy-2-methylpropane-1,3-diol (PubChem CID 90832132) has the molecular formula C10H23NO4 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(1-amino-1-hydroxy-3-methylpentan-2-yl)oxy-2-methylpropane-1,3-diol.
| Compound Name | 1-(1-amino-1-hydroxy-3-methylpentan-2-yl)oxy-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 90832132 |
| Molecular Formula | C10H23NO4 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1-(1-amino-1-hydroxy-3-methylpentan-2-yl)oxy-2-methylpropane-1,3-diol |
| SMILES | CCC(C)C(OC(O)C(C)CO)C(N)O |
| InChI | InChI=1S/C10H23NO4/c1-4-6(2)8(9(11)13)15-10(14)7(3)5-12/h6-10,12-14H,4-5,11H2,1-3H3 |
| InChIKey | JUHPWSZLUHSWGC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|