C7H18O9P+ — CID 89295387
trihydroxy-[(1R,4R)-1,2,3,4,6-pentahydroxy-5-methylhexoxy]phosphanium (PubChem CID 89295387) has the molecular formula C7H18O9P+ and a molecular weight of 277.19 g/mol. Its IUPAC name is trihydroxy-[(1R,4R)-1,2,3,4,6-pentahydroxy-5-methylhexoxy]phosphanium.
| Compound Name | trihydroxy-[(1R,4R)-1,2,3,4,6-pentahydroxy-5-methylhexoxy]phosphanium |
|---|---|
| PubChem CID | 89295387 |
| Molecular Formula | C7H18O9P+ |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | trihydroxy-[(1R,4R)-1,2,3,4,6-pentahydroxy-5-methylhexoxy]phosphanium |
| SMILES | CC(CO)[C@@H](O)C(O)C(O)[C@H](O)O[P+](O)(O)O |
| InChI | InChI=1S/C7H18O9P/c1-3(2-8)4(9)5(10)6(11)7(12)16-17(13,14)15/h3-15H,2H2,1H3/q+1/t3?,4-,5?,6?,7-/m1/s1 |
| InChIKey | XILSPKXUQCZJFV-XFQYLJLSSA-N |
| XLogP | -3.31 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|