C14H21NO8 — CID 139313609
5-methyl-1-[(4-nitrophenyl)methoxy]hexane-1,2,3,4,6-pentol (PubChem CID 139313609) has the molecular formula C14H21NO8 and a molecular weight of 331.32 g/mol. Its IUPAC name is 5-methyl-1-[(4-nitrophenyl)methoxy]hexane-1,2,3,4,6-pentol.
| Compound Name | 5-methyl-1-[(4-nitrophenyl)methoxy]hexane-1,2,3,4,6-pentol |
|---|---|
| PubChem CID | 139313609 |
| Molecular Formula | C14H21NO8 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 5-methyl-1-[(4-nitrophenyl)methoxy]hexane-1,2,3,4,6-pentol |
| SMILES | CC(CO)C(O)C(O)C(O)C(O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H21NO8/c1-8(6-16)11(17)12(18)13(19)14(20)23-7-9-2-4-10(5-3-9)15(21)22/h2-5,8,11-14,16-20H,6-7H2,1H3 |
| InChIKey | BADZYSUFOIPBGG-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|