C11H20 — CID 22223926
4,5,6-trimethyloct-2-yne (PubChem CID 22223926) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is 4,5,6-trimethyloct-2-yne.
| Compound Name | 4,5,6-trimethyloct-2-yne |
|---|---|
| PubChem CID | 22223926 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 4,5,6-trimethyloct-2-yne |
| SMILES | CC#CC(C)C(C)C(C)CC |
| InChI | InChI=1S/C11H20/c1-6-8-10(4)11(5)9(3)7-2/h9-11H,7H2,1-5H3 |
| InChIKey | VNBLYSJMWCBCKK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|