C13H22O3 — CID 24881622
(2S,4S,5R,6S)-4,5-dimethoxy-2,6-dimethylnon-7-ynal (PubChem CID 24881622) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (2S,4S,5R,6S)-4,5-dimethoxy-2,6-dimethylnon-7-ynal.
| Compound Name | (2S,4S,5R,6S)-4,5-dimethoxy-2,6-dimethylnon-7-ynal |
|---|---|
| PubChem CID | 24881622 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (2S,4S,5R,6S)-4,5-dimethoxy-2,6-dimethylnon-7-ynal |
| SMILES | CC#C[C@H](C)[C@@H](OC)[C@H](CC(C)C=O)OC |
| InChI | InChI=1S/C13H22O3/c1-6-7-11(3)13(16-5)12(15-4)8-10(2)9-14/h9-13H,8H2,1-5H3/t10?,11-,12-,13+/m0/s1 |
| InChIKey | RXVAZLRMRAJARL-FOIKRFTLSA-N |
| XLogP | 1.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|