C23H34O5 — CID 56957931
tert-butyl (3R,4R,5R,6R)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-4,6-dimethylnon-7-ynoate (PubChem CID 56957931) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is tert-butyl (3R,4R,5R,6R)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-4,6-dimethylnon-7-ynoate.
| Compound Name | tert-butyl (3R,4R,5R,6R)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-4,6-dimethylnon-7-ynoate |
|---|---|
| PubChem CID | 56957931 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | tert-butyl (3R,4R,5R,6R)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-4,6-dimethylnon-7-ynoate |
| SMILES | CC#C[C@@H](C)[C@@H](OCc1ccc(OC)cc1)[C@H](C)[C@H](O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34O5/c1-8-9-16(2)22(27-15-18-10-12-19(26-7)13-11-18)17(3)20(24)14-21(25)28-23(4,5)6/h10-13,16-17,20,22,24H,14-15H2,1-7H3/t16-,17-,20-,22-/m1/s1 |
| InChIKey | WJDIWMWVCJQASZ-ZFNVSSEQSA-N |
| XLogP | 3.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|