C23H26Cl3NO5 — CID 177419114
2,2,2-trichloro-N-[(2S,5R)-5-hydroxy-6-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyhex-3-en-2-yl]acetamide (PubChem CID 177419114) has the molecular formula C23H26Cl3NO5 and a molecular weight of 502.82 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(2S,5R)-5-hydroxy-6-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyhex-3-en-2-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(2S,5R)-5-hydroxy-6-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyhex-3-en-2-yl]acetamide |
|---|---|
| PubChem CID | 177419114 |
| Molecular Formula | C23H26Cl3NO5 |
| Molecular Weight | 502.82 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 2,2,2-trichloro-N-[(2S,5R)-5-hydroxy-6-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyhex-3-en-2-yl]acetamide |
| SMILES | COc1ccc(COC[C@H](O)C=C[C@@H](COCc2ccccc2)NC(=O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C23H26Cl3NO5/c1-30-21-11-7-18(8-12-21)14-32-16-20(28)10-9-19(27-22(29)23(24,25)26)15-31-13-17-5-3-2-4-6-17/h2-12,19-20,28H,13-16H2,1H3,(H,27,29)/t19-,20+/m0/s1 |
| InChIKey | FPJJCUWPLCSUMV-VQTJNVASSA-N |
| XLogP | 4.20 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.82 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|