C41H42Cl3NO7Si — CID 10327972
2,2,2-trichloro-N-[(2S,3R,4R)-1-hydroxy-3,4-bis[(4-methoxyphenyl)methoxy]-5-triphenylsilyloxypentan-2-yl]acetamide (PubChem CID 10327972) has the molecular formula C41H42Cl3NO7Si and a molecular weight of 795.23 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(2S,3R,4R)-1-hydroxy-3,4-bis[(4-methoxyphenyl)methoxy]-5-triphenylsilyloxypentan-2-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(2S,3R,4R)-1-hydroxy-3,4-bis[(4-methoxyphenyl)methoxy]-5-triphenylsilyloxypentan-2-yl]acetamide |
|---|---|
| PubChem CID | 10327972 |
| Molecular Formula | C41H42Cl3NO7Si |
| Molecular Weight | 795.23 g/mol |
| Exact Mass | 793.18 |
| IUPAC Name | 2,2,2-trichloro-N-[(2S,3R,4R)-1-hydroxy-3,4-bis[(4-methoxyphenyl)methoxy]-5-triphenylsilyloxypentan-2-yl]acetamide |
| SMILES | COc1ccc(CO[C@H]([C@H](CO)NC(=O)C(Cl)(Cl)Cl)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H42Cl3NO7Si/c1-48-32-22-18-30(19-23-32)27-50-38(39(37(26-46)45-40(47)41(42,43)44)51-28-31-20-24-33(49-2)25-21-31)29-52-53(34-12-6-3-7-13-34,35-14-8-4-9-15-35)36-16-10-5-11-17-36/h3-25,37-39,46H,26-29H2,1-2H3,(H,45,47)/t37-,38+,39+/m0/s1 |
| InChIKey | JQHAPPUAEQMVOS-LCKTVPPXSA-N |
| XLogP | 5.71 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.23 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|