C25H30Cl3NO6 — CID 101468782
2,2,2-trichloro-N-[(E,2S,5R)-5-(methoxymethoxy)-6-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyhex-3-en-2-yl]acetamide (PubChem CID 101468782) has the molecular formula C25H30Cl3NO6 and a molecular weight of 546.88 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(E,2S,5R)-5-(methoxymethoxy)-6-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyhex-3-en-2-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(E,2S,5R)-5-(methoxymethoxy)-6-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyhex-3-en-2-yl]acetamide |
|---|---|
| PubChem CID | 101468782 |
| Molecular Formula | C25H30Cl3NO6 |
| Molecular Weight | 546.88 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | 2,2,2-trichloro-N-[(E,2S,5R)-5-(methoxymethoxy)-6-[(4-methoxyphenyl)methoxy]-1-phenylmethoxyhex-3-en-2-yl]acetamide |
| SMILES | COCO[C@H](/C=C/[C@@H](COCc1ccccc1)NC(=O)C(Cl)(Cl)Cl)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H30Cl3NO6/c1-31-18-35-23(17-34-15-20-8-11-22(32-2)12-9-20)13-10-21(29-24(30)25(26,27)28)16-33-14-19-6-4-3-5-7-19/h3-13,21,23H,14-18H2,1-2H3,(H,29,30)/b13-10+/t21-,23+/m0/s1 |
| InChIKey | MCAGZFUKHLXCLT-BBUBECRKSA-N |
| XLogP | 4.83 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.88 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|