C16H20Cl3NO3 — CID 11668041
2,2,2-trichloro-N-[(3R,4S)-4-(methoxymethoxy)-6-phenylhex-1-en-3-yl]acetamide (PubChem CID 11668041) has the molecular formula C16H20Cl3NO3 and a molecular weight of 380.70 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(3R,4S)-4-(methoxymethoxy)-6-phenylhex-1-en-3-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(3R,4S)-4-(methoxymethoxy)-6-phenylhex-1-en-3-yl]acetamide |
|---|---|
| PubChem CID | 11668041 |
| Molecular Formula | C16H20Cl3NO3 |
| Molecular Weight | 380.70 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 2,2,2-trichloro-N-[(3R,4S)-4-(methoxymethoxy)-6-phenylhex-1-en-3-yl]acetamide |
| SMILES | C=C[C@@H](NC(=O)C(Cl)(Cl)Cl)[C@H](CCc1ccccc1)OCOC |
| InChI | InChI=1S/C16H20Cl3NO3/c1-3-13(20-15(21)16(17,18)19)14(23-11-22-2)10-9-12-7-5-4-6-8-12/h3-8,13-14H,1,9-11H2,2H3,(H,20,21)/t13-,14+/m1/s1 |
| InChIKey | DUPOHWABNFNPLO-KGLIPLIRSA-N |
| XLogP | 3.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.70 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|