C9H14Cl3NO3 — CID 11953349
2,2,2-trichloro-N-[(3S,4S)-4-(methoxymethoxy)pent-1-en-3-yl]acetamide (PubChem CID 11953349) has the molecular formula C9H14Cl3NO3 and a molecular weight of 290.57 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(3S,4S)-4-(methoxymethoxy)pent-1-en-3-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(3S,4S)-4-(methoxymethoxy)pent-1-en-3-yl]acetamide |
|---|---|
| PubChem CID | 11953349 |
| Molecular Formula | C9H14Cl3NO3 |
| Molecular Weight | 290.57 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 2,2,2-trichloro-N-[(3S,4S)-4-(methoxymethoxy)pent-1-en-3-yl]acetamide |
| SMILES | C=C[C@H](NC(=O)C(Cl)(Cl)Cl)[C@H](C)OCOC |
| InChI | InChI=1S/C9H14Cl3NO3/c1-4-7(6(2)16-5-15-3)13-8(14)9(10,11)12/h4,6-7H,1,5H2,2-3H3,(H,13,14)/t6-,7-/m0/s1 |
| InChIKey | VLBJKOJDBLNTMM-BQBZGAKWSA-N |
| XLogP | 2.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|