C11H20O3 — CID 100934483
(E)-6-(methoxymethoxy)-2,2-dimethylhept-4-en-3-one (PubChem CID 100934483) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (E)-6-(methoxymethoxy)-2,2-dimethylhept-4-en-3-one.
| Compound Name | (E)-6-(methoxymethoxy)-2,2-dimethylhept-4-en-3-one |
|---|---|
| PubChem CID | 100934483 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (E)-6-(methoxymethoxy)-2,2-dimethylhept-4-en-3-one |
| SMILES | COCOC(C)/C=C/C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H20O3/c1-9(14-8-13-5)6-7-10(12)11(2,3)4/h6-7,9H,8H2,1-5H3/b7-6+ |
| InChIKey | SONOVWUGJCHZLL-VOTSOKGWSA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|