C17H20O3 — CID 101173435
(2R)-3-[(4-methoxyphenyl)methoxy]-2-phenylpropan-1-ol (PubChem CID 101173435) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is (2R)-3-[(4-methoxyphenyl)methoxy]-2-phenylpropan-1-ol.
| Compound Name | (2R)-3-[(4-methoxyphenyl)methoxy]-2-phenylpropan-1-ol |
|---|---|
| PubChem CID | 101173435 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (2R)-3-[(4-methoxyphenyl)methoxy]-2-phenylpropan-1-ol |
| SMILES | COc1ccc(COC[C@@H](CO)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H20O3/c1-19-17-9-7-14(8-10-17)12-20-13-16(11-18)15-5-3-2-4-6-15/h2-10,16,18H,11-13H2,1H3/t16-/m1/s1 |
| InChIKey | UGMCVGQIEGGNDN-MRXNPFEDSA-N |
| XLogP | 2.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |