C35H53IO6 — CID 102174802
(Z,2S,3S,4S,5R,8S,10S,11R,12S)-14-iodo-1,11-bis[(4-methoxyphenyl)methoxy]-2,4,8,10,12-pentamethyltetradec-13-ene-3,5-diol (PubChem CID 102174802) has the molecular formula C35H53IO6 and a molecular weight of 696.71 g/mol. Its IUPAC name is (Z,2S,3S,4S,5R,8S,10S,11R,12S)-14-iodo-1,11-bis[(4-methoxyphenyl)methoxy]-2,4,8,10,12-pentamethyltetradec-13-ene-3,5-diol.
| Compound Name | (Z,2S,3S,4S,5R,8S,10S,11R,12S)-14-iodo-1,11-bis[(4-methoxyphenyl)methoxy]-2,4,8,10,12-pentamethyltetradec-13-ene-3,5-diol |
|---|---|
| PubChem CID | 102174802 |
| Molecular Formula | C35H53IO6 |
| Molecular Weight | 696.71 g/mol |
| Exact Mass | 696.29 |
| IUPAC Name | (Z,2S,3S,4S,5R,8S,10S,11R,12S)-14-iodo-1,11-bis[(4-methoxyphenyl)methoxy]-2,4,8,10,12-pentamethyltetradec-13-ene-3,5-diol |
| SMILES | COc1ccc(COC[C@H](C)[C@H](O)[C@@H](C)[C@H](O)CC[C@H](C)C[C@H](C)[C@@H](OCc2ccc(OC)cc2)[C@@H](C)/C=C\I)cc1 |
| InChI | InChI=1S/C35H53IO6/c1-24(20-26(3)35(25(2)18-19-36)42-23-30-11-15-32(40-7)16-12-30)8-17-33(37)28(5)34(38)27(4)21-41-22-29-9-13-31(39-6)14-10-29/h9-16,18-19,24-28,33-35,37-38H,8,17,20-23H2,1-7H3/b19-18-/t24-,25-,26-,27-,28-,33+,34-,35-/m0/s1 |
| InChIKey | RFKFAHDAQCLFQT-XZSGSEGJSA-N |
| XLogP | 7.83 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.71 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|