C23H31NO — CID 11267709
(2R)-2-[benzyl-[(E,2R)-5,5-dimethylhex-3-en-2-yl]amino]-2-phenylethanol (PubChem CID 11267709) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is (2R)-2-[benzyl-[(E,2R)-5,5-dimethylhex-3-en-2-yl]amino]-2-phenylethanol.
| Compound Name | (2R)-2-[benzyl-[(E,2R)-5,5-dimethylhex-3-en-2-yl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 11267709 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (2R)-2-[benzyl-[(E,2R)-5,5-dimethylhex-3-en-2-yl]amino]-2-phenylethanol |
| SMILES | C[C@H](/C=C/C(C)(C)C)N(Cc1ccccc1)[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C23H31NO/c1-19(15-16-23(2,3)4)24(17-20-11-7-5-8-12-20)22(18-25)21-13-9-6-10-14-21/h5-16,19,22,25H,17-18H2,1-4H3/b16-15+/t19-,22+/m1/s1 |
| InChIKey | VCFNASMQRFBBHO-NAQYQCNUSA-N |
| XLogP | 5.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|