C26H36LiNO2 — CID 140586958
lithium (E,3S)-3-[benzyl(1-phenylethyl)amino]-1-[(2-methylpropan-2-yl)oxy]hept-1-en-1-olate (PubChem CID 140586958) has the molecular formula C26H36LiNO2 and a molecular weight of 401.52 g/mol. Its IUPAC name is lithium (E,3S)-3-[benzyl(1-phenylethyl)amino]-1-[(2-methylpropan-2-yl)oxy]hept-1-en-1-olate.
| Compound Name | lithium (E,3S)-3-[benzyl(1-phenylethyl)amino]-1-[(2-methylpropan-2-yl)oxy]hept-1-en-1-olate |
|---|---|
| PubChem CID | 140586958 |
| Molecular Formula | C26H36LiNO2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | lithium (E,3S)-3-[benzyl(1-phenylethyl)amino]-1-[(2-methylpropan-2-yl)oxy]hept-1-en-1-olate |
| SMILES | CCCC[C@@H](/C=C(\[O-])OC(C)(C)C)N(Cc1ccccc1)C(C)c1ccccc1.[Li+] |
| InChI | InChI=1S/C26H37NO2.Li/c1-6-7-18-24(19-25(28)29-26(3,4)5)27(20-22-14-10-8-11-15-22)21(2)23-16-12-9-13-17-23;/h8-17,19,21,24,28H,6-7,18,20H2,1-5H3;/q;+1/p-1/b25-19+;/t21?,24-;/m0./s1 |
| InChIKey | OMXSFNORUIDTRR-WYSMWGGASA-M |
| XLogP | 2.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|