C24H29NO — CID 101125405
(1R,2S)-1-phenyl-2-[[(1E,3S)-1-phenylhexa-1,5-dien-3-yl]-prop-2-enylamino]propan-1-ol (PubChem CID 101125405) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is (1R,2S)-1-phenyl-2-[[(1E,3S)-1-phenylhexa-1,5-dien-3-yl]-prop-2-enylamino]propan-1-ol.
| Compound Name | (1R,2S)-1-phenyl-2-[[(1E,3S)-1-phenylhexa-1,5-dien-3-yl]-prop-2-enylamino]propan-1-ol |
|---|---|
| PubChem CID | 101125405 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (1R,2S)-1-phenyl-2-[[(1E,3S)-1-phenylhexa-1,5-dien-3-yl]-prop-2-enylamino]propan-1-ol |
| SMILES | C=CC[C@@H](/C=C/c1ccccc1)N(CC=C)[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C24H29NO/c1-4-12-23(18-17-21-13-8-6-9-14-21)25(19-5-2)20(3)24(26)22-15-10-7-11-16-22/h4-11,13-18,20,23-24,26H,1-2,12,19H2,3H3/b18-17+/t20-,23-,24-/m0/s1 |
| InChIKey | XCPRKZBHCWYJHJ-MVOGYQIUSA-N |
| XLogP | 5.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|