C15H21NO — CID 11064277
(1S,2R)-2-[bis(prop-2-enyl)amino]-1-phenylpropan-1-ol (PubChem CID 11064277) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (1S,2R)-2-[bis(prop-2-enyl)amino]-1-phenylpropan-1-ol.
| Compound Name | (1S,2R)-2-[bis(prop-2-enyl)amino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 11064277 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (1S,2R)-2-[bis(prop-2-enyl)amino]-1-phenylpropan-1-ol |
| SMILES | C=CCN(CC=C)[C@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H21NO/c1-4-11-16(12-5-2)13(3)15(17)14-9-7-6-8-10-14/h4-10,13,15,17H,1-2,11-12H2,3H3/t13-,15-/m1/s1 |
| InChIKey | JIIURWPYHCVOGX-UKRRQHHQSA-N |
| XLogP | 2.78 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|