C22H28N2O2 — CID 24938979
2-[benzyl(prop-2-enyl)amino]-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide (PubChem CID 24938979) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-[benzyl(prop-2-enyl)amino]-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide.
| Compound Name | 2-[benzyl(prop-2-enyl)amino]-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 24938979 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2-[benzyl(prop-2-enyl)amino]-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide |
| SMILES | C=CCN(CC(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O2/c1-4-15-24(16-19-11-7-5-8-12-19)17-21(25)23(3)18(2)22(26)20-13-9-6-10-14-20/h4-14,18,22,26H,1,15-17H2,2-3H3/t18-,22+/m0/s1 |
| InChIKey | GOFPITGAVVMHRU-PGRDOPGGSA-N |
| XLogP | 3.26 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|