C22H28OS2 — CID 11428732
trans-(1S,2R)-2-[2,2-bis(phenylsulfanyl)ethyl]-3,3-dimethylcyclohexan-1-ol (PubChem CID 11428732) has the molecular formula C22H28OS2 and a molecular weight of 372.60 g/mol. Its IUPAC name is trans-(1S,2R)-2-[2,2-bis(phenylsulfanyl)ethyl]-3,3-dimethylcyclohexan-1-ol.
| Compound Name | trans-(1S,2R)-2-[2,2-bis(phenylsulfanyl)ethyl]-3,3-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11428732 |
| Molecular Formula | C22H28OS2 |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | trans-(1S,2R)-2-[2,2-bis(phenylsulfanyl)ethyl]-3,3-dimethylcyclohexan-1-ol |
| SMILES | CC1(C)CCC[C@H](O)[C@@H]1CC(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C22H28OS2/c1-22(2)15-9-14-20(23)19(22)16-21(24-17-10-5-3-6-11-17)25-18-12-7-4-8-13-18/h3-8,10-13,19-21,23H,9,14-16H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | IHMNHCZBKKNCDT-PMACEKPBSA-N |
| XLogP | 6.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|