C12H13F3S — CID 14959289
1,1,1-trifluorohex-5-en-3-ylsulfanylbenzene (PubChem CID 14959289) has the molecular formula C12H13F3S and a molecular weight of 246.30 g/mol. Its IUPAC name is 1,1,1-trifluorohex-5-en-3-ylsulfanylbenzene.
| Compound Name | 1,1,1-trifluorohex-5-en-3-ylsulfanylbenzene |
|---|---|
| PubChem CID | 14959289 |
| Molecular Formula | C12H13F3S |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 1,1,1-trifluorohex-5-en-3-ylsulfanylbenzene |
| SMILES | C=CCC(CC(F)(F)F)Sc1ccccc1 |
| InChI | InChI=1S/C12H13F3S/c1-2-6-11(9-12(13,14)15)16-10-7-4-3-5-8-10/h2-5,7-8,11H,1,6,9H2 |
| InChIKey | LNLCZQJHBAMYCJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|