C24H17F5O3 — CID 132608841
(2,3,4,5,6-pentafluorophenyl) (2R,3S)-2-(4-methoxyphenyl)-3-phenylpent-4-enoate (PubChem CID 132608841) has the molecular formula C24H17F5O3 and a molecular weight of 448.39 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2R,3S)-2-(4-methoxyphenyl)-3-phenylpent-4-enoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2R,3S)-2-(4-methoxyphenyl)-3-phenylpent-4-enoate |
|---|---|
| PubChem CID | 132608841 |
| Molecular Formula | C24H17F5O3 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2R,3S)-2-(4-methoxyphenyl)-3-phenylpent-4-enoate |
| SMILES | C=C[C@H](c1ccccc1)[C@@H](C(=O)Oc1c(F)c(F)c(F)c(F)c1F)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H17F5O3/c1-3-16(13-7-5-4-6-8-13)17(14-9-11-15(31-2)12-10-14)24(30)32-23-21(28)19(26)18(25)20(27)22(23)29/h3-12,16-17H,1H2,2H3/t16-,17+/m1/s1 |
| InChIKey | HCTUOGFJSIZZDD-SJORKVTESA-N |
| XLogP | 6.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|