C21H14F5NO3S — CID 139124869
(2,3,4,5,6-pentafluorophenyl) (2S,3S)-2-(4-methoxyphenyl)-3-(1,3-thiazol-5-yl)pent-4-enoate (PubChem CID 139124869) has the molecular formula C21H14F5NO3S and a molecular weight of 455.40 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2S,3S)-2-(4-methoxyphenyl)-3-(1,3-thiazol-5-yl)pent-4-enoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2S,3S)-2-(4-methoxyphenyl)-3-(1,3-thiazol-5-yl)pent-4-enoate |
|---|---|
| PubChem CID | 139124869 |
| Molecular Formula | C21H14F5NO3S |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2S,3S)-2-(4-methoxyphenyl)-3-(1,3-thiazol-5-yl)pent-4-enoate |
| SMILES | C=C[C@H](c1cncs1)[C@H](C(=O)Oc1c(F)c(F)c(F)c(F)c1F)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H14F5NO3S/c1-3-12(13-8-27-9-31-13)14(10-4-6-11(29-2)7-5-10)21(28)30-20-18(25)16(23)15(22)17(24)19(20)26/h3-9,12,14H,1H2,2H3/t12-,14-/m1/s1 |
| InChIKey | NXLMNPZGMWCMQA-TZMCWYRMSA-N |
| XLogP | 5.51 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|