C12H11F3O2S — CID 130365785
4-(4-methylphenyl)-4-oxo-2-(trifluoromethyl)butanethioic S-acid (PubChem CID 130365785) has the molecular formula C12H11F3O2S and a molecular weight of 276.28 g/mol. Its IUPAC name is 4-(4-methylphenyl)-4-oxo-2-(trifluoromethyl)butanethioic S-acid.
| Compound Name | 4-(4-methylphenyl)-4-oxo-2-(trifluoromethyl)butanethioic S-acid |
|---|---|
| PubChem CID | 130365785 |
| Molecular Formula | C12H11F3O2S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 4-(4-methylphenyl)-4-oxo-2-(trifluoromethyl)butanethioic S-acid |
| SMILES | Cc1ccc(C(=O)CC(C(=O)S)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F3O2S/c1-7-2-4-8(5-3-7)10(16)6-9(11(17)18)12(13,14)15/h2-5,9H,6H2,1H3,(H,17,18) |
| InChIKey | FXMISUCSQPQYKN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|