C21H18F3NO3 — CID 122403551
methyl (2R,3S)-2-isocyano-5-(4-methylphenyl)-5-oxo-2-phenyl-3-(trifluoromethyl)pentanoate (PubChem CID 122403551) has the molecular formula C21H18F3NO3 and a molecular weight of 389.37 g/mol. Its IUPAC name is methyl (2R,3S)-2-isocyano-5-(4-methylphenyl)-5-oxo-2-phenyl-3-(trifluoromethyl)pentanoate.
| Compound Name | methyl (2R,3S)-2-isocyano-5-(4-methylphenyl)-5-oxo-2-phenyl-3-(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 122403551 |
| Molecular Formula | C21H18F3NO3 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | methyl (2R,3S)-2-isocyano-5-(4-methylphenyl)-5-oxo-2-phenyl-3-(trifluoromethyl)pentanoate |
| SMILES | [C-]#[N+][C@@](C(=O)OC)(c1ccccc1)[C@H](CC(=O)c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H18F3NO3/c1-14-9-11-15(12-10-14)17(26)13-18(21(22,23)24)20(25-2,19(27)28-3)16-7-5-4-6-8-16/h4-12,18H,13H2,1,3H3/t18-,20-/m0/s1 |
| InChIKey | LHRPXDSRFIXDLA-ICSRJNTNSA-N |
| XLogP | 4.73 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|