C20H15F4NO3 — CID 122403538
methyl (2R,3S)-2-(4-fluorophenyl)-2-isocyano-5-oxo-5-phenyl-3-(trifluoromethyl)pentanoate (PubChem CID 122403538) has the molecular formula C20H15F4NO3 and a molecular weight of 393.34 g/mol. Its IUPAC name is methyl (2R,3S)-2-(4-fluorophenyl)-2-isocyano-5-oxo-5-phenyl-3-(trifluoromethyl)pentanoate.
| Compound Name | methyl (2R,3S)-2-(4-fluorophenyl)-2-isocyano-5-oxo-5-phenyl-3-(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 122403538 |
| Molecular Formula | C20H15F4NO3 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | methyl (2R,3S)-2-(4-fluorophenyl)-2-isocyano-5-oxo-5-phenyl-3-(trifluoromethyl)pentanoate |
| SMILES | [C-]#[N+][C@@](C(=O)OC)(c1ccc(F)cc1)[C@H](CC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H15F4NO3/c1-25-19(18(27)28-2,14-8-10-15(21)11-9-14)17(20(22,23)24)12-16(26)13-6-4-3-5-7-13/h3-11,17H,12H2,2H3/t17-,19-/m0/s1 |
| InChIKey | QUKWWHYAUBAOCJ-HKUYNNGSSA-N |
| XLogP | 4.56 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|