C25H32O5 — CID 175442862
methyl 4-tert-butylperoxy-2-[2-(4-methylphenyl)-2-oxoethyl]-4-phenylpentanoate (PubChem CID 175442862) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is methyl 4-tert-butylperoxy-2-[2-(4-methylphenyl)-2-oxoethyl]-4-phenylpentanoate.
| Compound Name | methyl 4-tert-butylperoxy-2-[2-(4-methylphenyl)-2-oxoethyl]-4-phenylpentanoate |
|---|---|
| PubChem CID | 175442862 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | methyl 4-tert-butylperoxy-2-[2-(4-methylphenyl)-2-oxoethyl]-4-phenylpentanoate |
| SMILES | COC(=O)C(CC(=O)c1ccc(C)cc1)CC(C)(OOC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H32O5/c1-18-12-14-19(15-13-18)22(26)16-20(23(27)28-6)17-25(5,30-29-24(2,3)4)21-10-8-7-9-11-21/h7-15,20H,16-17H2,1-6H3 |
| InChIKey | HDMGYTNVZLQLBT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|