C9H9BrO5S — CID 46929386
3-(4-bromophenyl)-1-hydroxy-3-oxopropane-1-sulfonic acid (PubChem CID 46929386) has the molecular formula C9H9BrO5S and a molecular weight of 309.14 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-hydroxy-3-oxopropane-1-sulfonic acid.
| Compound Name | 3-(4-bromophenyl)-1-hydroxy-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 46929386 |
| Molecular Formula | C9H9BrO5S |
| Molecular Weight | 309.14 g/mol |
| Exact Mass | 307.94 |
| IUPAC Name | 3-(4-bromophenyl)-1-hydroxy-3-oxopropane-1-sulfonic acid |
| SMILES | O=C(CC(O)S(=O)(=O)O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H9BrO5S/c10-7-3-1-6(2-4-7)8(11)5-9(12)16(13,14)15/h1-4,9,12H,5H2,(H,13,14,15) |
| InChIKey | MEMKMLBOUHUGJU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.14 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|