C36H24Br2O2 — CID 102318712
2,3-bis(4-bromophenyl)-1,4-dinaphthalen-2-ylbutane-1,4-dione (PubChem CID 102318712) has the molecular formula C36H24Br2O2 and a molecular weight of 648.39 g/mol. Its IUPAC name is 2,3-bis(4-bromophenyl)-1,4-dinaphthalen-2-ylbutane-1,4-dione.
| Compound Name | 2,3-bis(4-bromophenyl)-1,4-dinaphthalen-2-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 102318712 |
| Molecular Formula | C36H24Br2O2 |
| Molecular Weight | 648.39 g/mol |
| Exact Mass | 646.01 |
| IUPAC Name | 2,3-bis(4-bromophenyl)-1,4-dinaphthalen-2-ylbutane-1,4-dione |
| SMILES | O=C(c1ccc2ccccc2c1)C(c1ccc(Br)cc1)C(C(=O)c1ccc2ccccc2c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C36H24Br2O2/c37-31-17-13-25(14-18-31)33(35(39)29-11-9-23-5-1-3-7-27(23)21-29)34(26-15-19-32(38)20-16-26)36(40)30-12-10-24-6-2-4-8-28(24)22-30/h1-22,33-34H |
| InChIKey | FPUZWSHIQMBDPW-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.39 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |