C10H12BrNO3 — CID 14314190
methyl (2R,3S)-2-amino-3-(4-bromophenyl)-3-hydroxypropanoate (PubChem CID 14314190) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is methyl (2R,3S)-2-amino-3-(4-bromophenyl)-3-hydroxypropanoate.
| Compound Name | methyl (2R,3S)-2-amino-3-(4-bromophenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 14314190 |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | methyl (2R,3S)-2-amino-3-(4-bromophenyl)-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](N)[C@@H](O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H12BrNO3/c1-15-10(14)8(12)9(13)6-2-4-7(11)5-3-6/h2-5,8-9,13H,12H2,1H3/t8-,9+/m1/s1 |
| InChIKey | GGEOMIROLXVKST-BDAKNGLRSA-N |
| XLogP | 0.98 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |