C11H13NO5S — CID 58339748
methyl (2S,3R)-2-amino-3-hydroxy-3-(4-methanethioylperoxyphenyl)propanoate (PubChem CID 58339748) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is methyl (2S,3R)-2-amino-3-hydroxy-3-(4-methanethioylperoxyphenyl)propanoate.
| Compound Name | methyl (2S,3R)-2-amino-3-hydroxy-3-(4-methanethioylperoxyphenyl)propanoate |
|---|---|
| PubChem CID | 58339748 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | methyl (2S,3R)-2-amino-3-hydroxy-3-(4-methanethioylperoxyphenyl)propanoate |
| SMILES | COC(=O)[C@@H](N)[C@H](O)c1ccc(OOC=S)cc1 |
| InChI | InChI=1S/C11H13NO5S/c1-15-11(14)9(12)10(13)7-2-4-8(5-3-7)17-16-6-18/h2-6,9-10,13H,12H2,1H3/t9-,10+/m0/s1 |
| InChIKey | XFQNQOIPVXNKIU-VHSXEESVSA-N |
| XLogP | 0.49 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|