C26H27N3O4 — CID 19749280
[4-[(3,6-dimethoxyacridin-9-yl)amino]phenyl]methyl N-propan-2-ylcarbamate (PubChem CID 19749280) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is [4-[(3,6-dimethoxyacridin-9-yl)amino]phenyl]methyl N-propan-2-ylcarbamate.
| Compound Name | [4-[(3,6-dimethoxyacridin-9-yl)amino]phenyl]methyl N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 19749280 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | [4-[(3,6-dimethoxyacridin-9-yl)amino]phenyl]methyl N-propan-2-ylcarbamate |
| SMILES | COc1ccc2c(Nc3ccc(COC(=O)NC(C)C)cc3)c3ccc(OC)cc3nc2c1 |
| InChI | InChI=1S/C26H27N3O4/c1-16(2)27-26(30)33-15-17-5-7-18(8-6-17)28-25-21-11-9-19(31-3)13-23(21)29-24-14-20(32-4)10-12-22(24)25/h5-14,16H,15H2,1-4H3,(H,27,30)(H,28,29) |
| InChIKey | VHAZEJYISAAKCT-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|