C27H29N3O3 — CID 19749369
2-[4-[(6-methoxy-2-methylacridin-9-yl)amino]phenyl]ethyl N-propan-2-ylcarbamate (PubChem CID 19749369) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-[4-[(6-methoxy-2-methylacridin-9-yl)amino]phenyl]ethyl N-propan-2-ylcarbamate.
| Compound Name | 2-[4-[(6-methoxy-2-methylacridin-9-yl)amino]phenyl]ethyl N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 19749369 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 2-[4-[(6-methoxy-2-methylacridin-9-yl)amino]phenyl]ethyl N-propan-2-ylcarbamate |
| SMILES | COc1ccc2c(Nc3ccc(CCOC(=O)NC(C)C)cc3)c3cc(C)ccc3nc2c1 |
| InChI | InChI=1S/C27H29N3O3/c1-17(2)28-27(31)33-14-13-19-6-8-20(9-7-19)29-26-22-11-10-21(32-4)16-25(22)30-24-12-5-18(3)15-23(24)26/h5-12,15-17H,13-14H2,1-4H3,(H,28,31)(H,29,30) |
| InChIKey | WMUMGCVJJPMDGK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|