C28H31N3O3 — CID 19749407
2-[4-[(3-methoxy-2,7-dimethylacridin-9-yl)amino]phenyl]ethyl N-propan-2-ylcarbamate (PubChem CID 19749407) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is 2-[4-[(3-methoxy-2,7-dimethylacridin-9-yl)amino]phenyl]ethyl N-propan-2-ylcarbamate.
| Compound Name | 2-[4-[(3-methoxy-2,7-dimethylacridin-9-yl)amino]phenyl]ethyl N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 19749407 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 2-[4-[(3-methoxy-2,7-dimethylacridin-9-yl)amino]phenyl]ethyl N-propan-2-ylcarbamate |
| SMILES | COc1cc2nc3ccc(C)cc3c(Nc3ccc(CCOC(=O)NC(C)C)cc3)c2cc1C |
| InChI | InChI=1S/C28H31N3O3/c1-17(2)29-28(32)34-13-12-20-7-9-21(10-8-20)30-27-22-14-18(3)6-11-24(22)31-25-16-26(33-5)19(4)15-23(25)27/h6-11,14-17H,12-13H2,1-5H3,(H,29,32)(H,30,31) |
| InChIKey | BPTHEFDQUVPRLV-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|