C23H21N3O3 — CID 19749110
[3-[(3-methoxyacridin-9-yl)amino]phenyl]methyl N-methylcarbamate (PubChem CID 19749110) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is [3-[(3-methoxyacridin-9-yl)amino]phenyl]methyl N-methylcarbamate.
| Compound Name | [3-[(3-methoxyacridin-9-yl)amino]phenyl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 19749110 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | [3-[(3-methoxyacridin-9-yl)amino]phenyl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1cccc(Nc2c3ccccc3nc3cc(OC)ccc23)c1 |
| InChI | InChI=1S/C23H21N3O3/c1-24-23(27)29-14-15-6-5-7-16(12-15)25-22-18-8-3-4-9-20(18)26-21-13-17(28-2)10-11-19(21)22/h3-13H,14H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | WHQGLHBSMAJJII-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|