C11H14F2OS — CID 63813506
(4-tert-butylsulfanyl-3,5-difluorophenyl)methanol (PubChem CID 63813506) has the molecular formula C11H14F2OS and a molecular weight of 232.29 g/mol. Its IUPAC name is (4-tert-butylsulfanyl-3,5-difluorophenyl)methanol.
| Compound Name | (4-tert-butylsulfanyl-3,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 63813506 |
| Molecular Formula | C11H14F2OS |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (4-tert-butylsulfanyl-3,5-difluorophenyl)methanol |
| SMILES | CC(C)(C)Sc1c(F)cc(CO)cc1F |
| InChI | InChI=1S/C11H14F2OS/c1-11(2,3)15-10-8(12)4-7(6-14)5-9(10)13/h4-5,14H,6H2,1-3H3 |
| InChIKey | OGBOOWRQKHOLGN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |