C8H5F2NO — CID 155654687
(3,5-difluoro-4-isocyanophenyl)methanol (PubChem CID 155654687) has the molecular formula C8H5F2NO and a molecular weight of 169.13 g/mol. Its IUPAC name is (3,5-difluoro-4-isocyanophenyl)methanol.
| Compound Name | (3,5-difluoro-4-isocyanophenyl)methanol |
|---|---|
| PubChem CID | 155654687 |
| Molecular Formula | C8H5F2NO |
| Molecular Weight | 169.13 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | (3,5-difluoro-4-isocyanophenyl)methanol |
| SMILES | [C-]#[N+]c1c(F)cc(CO)cc1F |
| InChI | InChI=1S/C8H5F2NO/c1-11-8-6(9)2-5(4-12)3-7(8)10/h2-3,12H,4H2 |
| InChIKey | YCGPGIJIUABIBU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.13 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|