C12H12FNO2 — CID 171417589
(8-fluoro-9-isocyano-2,3,4,5-tetrahydro-1-benzoxepin-6-yl)methanol (PubChem CID 171417589) has the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. Its IUPAC name is (8-fluoro-9-isocyano-2,3,4,5-tetrahydro-1-benzoxepin-6-yl)methanol.
| Compound Name | (8-fluoro-9-isocyano-2,3,4,5-tetrahydro-1-benzoxepin-6-yl)methanol |
|---|---|
| PubChem CID | 171417589 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | (8-fluoro-9-isocyano-2,3,4,5-tetrahydro-1-benzoxepin-6-yl)methanol |
| SMILES | [C-]#[N+]c1c(F)cc(CO)c2c1OCCCC2 |
| InChI | InChI=1S/C12H12FNO2/c1-14-11-10(13)6-8(7-15)9-4-2-3-5-16-12(9)11/h6,15H,2-5,7H2 |
| InChIKey | LWPKGSNNIAUIAQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 33.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|