C14H14FNO2 — CID 176639780
6-fluoro-7-isocyano-4-(oxan-4-yl)-2,3-dihydro-1-benzofuran (PubChem CID 176639780) has the molecular formula C14H14FNO2 and a molecular weight of 247.27 g/mol. Its IUPAC name is 6-fluoro-7-isocyano-4-(oxan-4-yl)-2,3-dihydro-1-benzofuran.
| Compound Name | 6-fluoro-7-isocyano-4-(oxan-4-yl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 176639780 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 6-fluoro-7-isocyano-4-(oxan-4-yl)-2,3-dihydro-1-benzofuran |
| SMILES | [C-]#[N+]c1c(F)cc(C2CCOCC2)c2c1OCC2 |
| InChI | InChI=1S/C14H14FNO2/c1-16-13-12(15)8-11(9-2-5-17-6-3-9)10-4-7-18-14(10)13/h8-9H,2-7H2 |
| InChIKey | SOMNBFAOTGEDON-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|