C9H5Br2F3 — CID 175317835
1-(1,2-dibromoethenyl)-4-(trifluoromethyl)benzene (PubChem CID 175317835) has the molecular formula C9H5Br2F3 and a molecular weight of 329.94 g/mol. Its IUPAC name is 1-(1,2-dibromoethenyl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(1,2-dibromoethenyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 175317835 |
| Molecular Formula | C9H5Br2F3 |
| Molecular Weight | 329.94 g/mol |
| Exact Mass | 327.87 |
| IUPAC Name | 1-(1,2-dibromoethenyl)-4-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1ccc(C(Br)=CBr)cc1 |
| InChI | InChI=1S/C9H5Br2F3/c10-5-8(11)6-1-3-7(4-2-6)9(12,13)14/h1-5H |
| InChIKey | HYLSFSGLFLRCFC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.94 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |