C11H9F3N2 — CID 138624935
(E)-2-(methylamino)-3-[4-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 138624935) has the molecular formula C11H9F3N2 and a molecular weight of 226.20 g/mol. Its IUPAC name is (E)-2-(methylamino)-3-[4-(trifluoromethyl)phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(methylamino)-3-[4-(trifluoromethyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 138624935 |
| Molecular Formula | C11H9F3N2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | (E)-2-(methylamino)-3-[4-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | CN/C(C#N)=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F3N2/c1-16-10(7-15)6-8-2-4-9(5-3-8)11(12,13)14/h2-6,16H,1H3/b10-6+ |
| InChIKey | WOJMDHGVNVMOEF-UXBLZVDNSA-N |
| XLogP | 2.79 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|