C17H23N — CID 177031340
(2Z)-2-[(4-tert-butylphenyl)methylidene]-3,3-dimethylbutanenitrile (PubChem CID 177031340) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is (2Z)-2-[(4-tert-butylphenyl)methylidene]-3,3-dimethylbutanenitrile.
| Compound Name | (2Z)-2-[(4-tert-butylphenyl)methylidene]-3,3-dimethylbutanenitrile |
|---|---|
| PubChem CID | 177031340 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (2Z)-2-[(4-tert-butylphenyl)methylidene]-3,3-dimethylbutanenitrile |
| SMILES | CC(C)(C)/C(C#N)=C/c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H23N/c1-16(2,3)14-9-7-13(8-10-14)11-15(12-18)17(4,5)6/h7-11H,1-6H3/b15-11+ |
| InChIKey | HVJWXUZSAMCCLL-RVDMUPIBSA-N |
| XLogP | 4.94 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|